C11H24N2O2 — CID 103108355
N-ethyl-2-[(3-hydroxy-3-methylbutyl)amino]-N-methylpropanamide (PubChem CID 103108355) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is N-ethyl-2-[(3-hydroxy-3-methylbutyl)amino]-N-methylpropanamide.
| Compound Name | N-ethyl-2-[(3-hydroxy-3-methylbutyl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 103108355 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | N-ethyl-2-[(3-hydroxy-3-methylbutyl)amino]-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)NCCC(C)(C)O |
| InChI | InChI=1S/C11H24N2O2/c1-6-13(5)10(14)9(2)12-8-7-11(3,4)15/h9,12,15H,6-8H2,1-5H3 |
| InChIKey | HZFJPOGVRNRYLC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |