C25H25N7OS — CID 10310845
2-N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-4-N-(1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 10310845) has the molecular formula C25H25N7OS and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-4-N-(1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-4-N-(1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10310845 |
| Molecular Formula | C25H25N7OS |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-4-N-(1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CC1CN(c2ccc(Nc3nc(Nc4ccc5[nH]ncc5c4)c4sccc4n3)cc2)CC(C)O1 |
| InChI | InChI=1S/C25H25N7OS/c1-15-13-32(14-16(2)33-15)20-6-3-18(4-7-20)28-25-29-22-9-10-34-23(22)24(30-25)27-19-5-8-21-17(11-19)12-26-31-21/h3-12,15-16H,13-14H2,1-2H3,(H,26,31)(H2,27,28,29,30) |
| InChIKey | XPTAXIJFLRVNCG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|