C23H25N9O3 — CID 10310914
4-(furan-2-yl)-10-[2-[3-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 10310914) has the molecular formula C23H25N9O3 and a molecular weight of 475.51 g/mol. Its IUPAC name is 4-(furan-2-yl)-10-[2-[3-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 4-(furan-2-yl)-10-[2-[3-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 10310914 |
| Molecular Formula | C23H25N9O3 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 4-(furan-2-yl)-10-[2-[3-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | COCCOc1cnc2c(c1)CN(CCn1ncc3c1nc(N)n1nc(-c4ccco4)nc31)CC2 |
| InChI | InChI=1S/C23H25N9O3/c1-33-9-10-34-16-11-15-14-30(5-4-18(15)25-12-16)6-7-31-21-17(13-26-31)22-27-20(19-3-2-8-35-19)29-32(22)23(24)28-21/h2-3,8,11-13H,4-7,9-10,14H2,1H3,(H2,24,28) |
| InChIKey | WTVGRQMKZKEDRJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|