C24H27N7O2S — CID 10310961
3-(dimethylamino)propyl N-[4-[4-amino-5-(5-methyl-1H-pyrazol-3-yl)quinazolin-2-yl]sulfanylphenyl]carbamate (PubChem CID 10310961) has the molecular formula C24H27N7O2S and a molecular weight of 477.59 g/mol. Its IUPAC name is 3-(dimethylamino)propyl N-[4-[4-amino-5-(5-methyl-1H-pyrazol-3-yl)quinazolin-2-yl]sulfanylphenyl]carbamate.
| Compound Name | 3-(dimethylamino)propyl N-[4-[4-amino-5-(5-methyl-1H-pyrazol-3-yl)quinazolin-2-yl]sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 10310961 |
| Molecular Formula | C24H27N7O2S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3-(dimethylamino)propyl N-[4-[4-amino-5-(5-methyl-1H-pyrazol-3-yl)quinazolin-2-yl]sulfanylphenyl]carbamate |
| SMILES | Cc1cc(-c2cccc3nc(Sc4ccc(NC(=O)OCCCN(C)C)cc4)nc(N)c23)n[nH]1 |
| InChI | InChI=1S/C24H27N7O2S/c1-15-14-20(30-29-15)18-6-4-7-19-21(18)22(25)28-23(27-19)34-17-10-8-16(9-11-17)26-24(32)33-13-5-12-31(2)3/h4,6-11,14H,5,12-13H2,1-3H3,(H,26,32)(H,29,30)(H2,25,27,28) |
| InChIKey | OTPZBNAGTMLCLI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|