C11H13N5O2 — CID 103110996
6-[(3-amino-2-methylphenyl)methylamino]-2H-1,2,4-triazine-3,5-dione (PubChem CID 103110996) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 6-[(3-amino-2-methylphenyl)methylamino]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(3-amino-2-methylphenyl)methylamino]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 103110996 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 6-[(3-amino-2-methylphenyl)methylamino]-2H-1,2,4-triazine-3,5-dione |
| SMILES | Cc1c(N)cccc1CNc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H13N5O2/c1-6-7(3-2-4-8(6)12)5-13-9-10(17)14-11(18)16-15-9/h2-4H,5,12H2,1H3,(H,13,15)(H2,14,16,17,18) |
| InChIKey | YLIJABNUKVYWNA-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|