C10H20N4O — CID 103111147
2-[(N'-cyclopropylcarbamimidoyl)amino]-N-ethyl-N-methylpropanamide (PubChem CID 103111147) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is 2-[(N'-cyclopropylcarbamimidoyl)amino]-N-ethyl-N-methylpropanamide.
| Compound Name | 2-[(N'-cyclopropylcarbamimidoyl)amino]-N-ethyl-N-methylpropanamide |
|---|---|
| PubChem CID | 103111147 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 2-[(N'-cyclopropylcarbamimidoyl)amino]-N-ethyl-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)N/C(N)=N/C1CC1 |
| InChI | InChI=1S/C10H20N4O/c1-4-14(3)9(15)7(2)12-10(11)13-8-5-6-8/h7-8H,4-6H2,1-3H3,(H3,11,12,13) |
| InChIKey | IJZBWHHZGXLJBA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|