C23H29ClN6O4 — CID 10311136
(2S,3R,4S)-6-amino-4-[4-chloro-2-methyl-N-[(2-methyltetrazol-5-yl)methyl]anilino]-2-(dimethoxymethyl)-2-methyl-3,4-dihydrochromen-3-ol (PubChem CID 10311136) has the molecular formula C23H29ClN6O4 and a molecular weight of 488.98 g/mol. Its IUPAC name is (2S,3R,4S)-6-amino-4-[4-chloro-2-methyl-N-[(2-methyltetrazol-5-yl)methyl]anilino]-2-(dimethoxymethyl)-2-methyl-3,4-dihydrochromen-3-ol.
| Compound Name | (2S,3R,4S)-6-amino-4-[4-chloro-2-methyl-N-[(2-methyltetrazol-5-yl)methyl]anilino]-2-(dimethoxymethyl)-2-methyl-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 10311136 |
| Molecular Formula | C23H29ClN6O4 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (2S,3R,4S)-6-amino-4-[4-chloro-2-methyl-N-[(2-methyltetrazol-5-yl)methyl]anilino]-2-(dimethoxymethyl)-2-methyl-3,4-dihydrochromen-3-ol |
| SMILES | COC(OC)[C@@]1(C)Oc2ccc(N)cc2[C@H](N(Cc2nnn(C)n2)c2ccc(Cl)cc2C)[C@H]1O |
| InChI | InChI=1S/C23H29ClN6O4/c1-13-10-14(24)6-8-17(13)30(12-19-26-28-29(3)27-19)20-16-11-15(25)7-9-18(16)34-23(2,21(20)31)22(32-4)33-5/h6-11,20-22,31H,12,25H2,1-5H3/t20-,21+,23-/m0/s1 |
| InChIKey | YPAXQTGDDQZZIA-XJUOHMSHSA-N |
| XLogP | 2.63 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|