C11H19N3O6 — CID 103112551
2-[[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]carbamoylamino]butanedioic acid (PubChem CID 103112551) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-[[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]carbamoylamino]butanedioic acid.
| Compound Name | 2-[[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]carbamoylamino]butanedioic acid |
|---|---|
| PubChem CID | 103112551 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]carbamoylamino]butanedioic acid |
| SMILES | CCN(C)C(=O)C(C)NC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19N3O6/c1-4-14(3)9(17)6(2)12-11(20)13-7(10(18)19)5-8(15)16/h6-7H,4-5H2,1-3H3,(H,15,16)(H,18,19)(H2,12,13,20) |
| InChIKey | FIMRKUDEVYBLQZ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |