C29H32N4O4 — CID 10311309
10-ethyl-10-hydroxy-23-pentyl-22-propyl-8-oxa-4,15,21,23-tetrazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19,21-octaene-5,9-dione (PubChem CID 10311309) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is 10-ethyl-10-hydroxy-23-pentyl-22-propyl-8-oxa-4,15,21,23-tetrazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19,21-octaene-5,9-dione.
| Compound Name | 10-ethyl-10-hydroxy-23-pentyl-22-propyl-8-oxa-4,15,21,23-tetrazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19,21-octaene-5,9-dione |
|---|---|
| PubChem CID | 10311309 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 10-ethyl-10-hydroxy-23-pentyl-22-propyl-8-oxa-4,15,21,23-tetrazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19,21-octaene-5,9-dione |
| SMILES | CCCCCN1C(CCC)=Nc2cccc3nc4c(c1c23)Cn1c-4cc2c(c1=O)COC(=O)C2(O)CC |
| InChI | InChI=1S/C29H32N4O4/c1-4-7-8-13-32-23(10-5-2)30-20-11-9-12-21-24(20)26(32)17-15-33-22(25(17)31-21)14-19-18(27(33)34)16-37-28(35)29(19,36)6-3/h9,11-12,14,36H,4-8,10,13,15-16H2,1-3H3 |
| InChIKey | UTGPCZXENDNUBY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|