About 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one
4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one (PubChem CID 103113150) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one |
| PubChem CID | 103113150 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one |
| SMILES | NCC1(c2csc(=O)[nH]2)CCC1 |
| InChI | InChI=1S/C8H12N2OS/c9-5-8(2-1-3-8)6-4-12-7(11)10-6/h4H,1-3,5,9H2,(H,10,11) |
| InChIKey | ZQPYRSKQENIIIM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one?
The IUPAC name of 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one (CID 103113150) is 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one is NCC1(c2csc(=O)[nH]2)CCC1.
What is the InChIKey of 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one?
The InChIKey is ZQPYRSKQENIIIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c9-5-8(2-1-3-8)6-4-12-7(11)10-6/h4H,1-3,5,9H2,(H,10,11).
What are the key properties of 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one?
4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one has a molecular weight of 184.26 g/mol, XLogP of 0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(aminomethyl)cyclobutyl]-3H-1,3-thiazol-2-one is sourced from PubChem (CID 103113150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).