C6H10N2O2S — CID 103113151
4-(1-amino-2-methoxyethyl)-3H-1,3-thiazol-2-one (PubChem CID 103113151) has the molecular formula C6H10N2O2S and a molecular weight of 174.22 g/mol. Its IUPAC name is 4-(1-amino-2-methoxyethyl)-3H-1,3-thiazol-2-one.
| Compound Name | 4-(1-amino-2-methoxyethyl)-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 103113151 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 4-(1-amino-2-methoxyethyl)-3H-1,3-thiazol-2-one |
| SMILES | COCC(N)c1csc(=O)[nH]1 |
| InChI | InChI=1S/C6H10N2O2S/c1-10-2-4(7)5-3-11-6(9)8-5/h3-4H,2,7H2,1H3,(H,8,9) |
| InChIKey | YAAVYILGPBDAKF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |