About 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate
2-methylpropyl 5-methyl-2H-triazole-4-carboxylate (PubChem CID 103113233) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate |
| PubChem CID | 103113233 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate |
| SMILES | Cc1n[nH]nc1C(=O)OCC(C)C |
| InChI | InChI=1S/C8H13N3O2/c1-5(2)4-13-8(12)7-6(3)9-11-10-7/h5H,4H2,1-3H3,(H,9,10,11) |
| InChIKey | JXTMHBKEMJMSQB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate?
The IUPAC name of 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate (CID 103113233) is 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate.
What is the SMILES notation for 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate?
The canonical SMILES for 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate is Cc1n[nH]nc1C(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate?
The InChIKey is JXTMHBKEMJMSQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-5(2)4-13-8(12)7-6(3)9-11-10-7/h5H,4H2,1-3H3,(H,9,10,11).
What are the key properties of 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate?
2-methylpropyl 5-methyl-2H-triazole-4-carboxylate has a molecular weight of 183.21 g/mol, XLogP of 0.93, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 5-methyl-2H-triazole-4-carboxylate is sourced from PubChem (CID 103113233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).