C15H19N3O3 — CID 103113632
methyl 1-[(3-methoxyphenyl)methyl]-5-propyltriazole-4-carboxylate (PubChem CID 103113632) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is methyl 1-[(3-methoxyphenyl)methyl]-5-propyltriazole-4-carboxylate.
| Compound Name | methyl 1-[(3-methoxyphenyl)methyl]-5-propyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103113632 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | methyl 1-[(3-methoxyphenyl)methyl]-5-propyltriazole-4-carboxylate |
| SMILES | CCCc1c(C(=O)OC)nnn1Cc1cccc(OC)c1 |
| InChI | InChI=1S/C15H19N3O3/c1-4-6-13-14(15(19)21-3)16-17-18(13)10-11-7-5-8-12(9-11)20-2/h5,7-9H,4,6,10H2,1-3H3 |
| InChIKey | PAOWBJUUHLVIBR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |