C14H22N4O3 — CID 103114298
prop-2-enyl 5-methyl-1-[2-(3-methylbutylamino)-2-oxoethyl]triazole-4-carboxylate (PubChem CID 103114298) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is prop-2-enyl 5-methyl-1-[2-(3-methylbutylamino)-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | prop-2-enyl 5-methyl-1-[2-(3-methylbutylamino)-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103114298 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | prop-2-enyl 5-methyl-1-[2-(3-methylbutylamino)-2-oxoethyl]triazole-4-carboxylate |
| SMILES | C=CCOC(=O)c1nnn(CC(=O)NCCC(C)C)c1C |
| InChI | InChI=1S/C14H22N4O3/c1-5-8-21-14(20)13-11(4)18(17-16-13)9-12(19)15-7-6-10(2)3/h5,10H,1,6-9H2,2-4H3,(H,15,19) |
| InChIKey | AFQKDSUXSVPNGO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|