C14H21N3O2 — CID 103114452
prop-2-enyl 5-methyl-1-(3-methylcyclohexyl)triazole-4-carboxylate (PubChem CID 103114452) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is prop-2-enyl 5-methyl-1-(3-methylcyclohexyl)triazole-4-carboxylate.
| Compound Name | prop-2-enyl 5-methyl-1-(3-methylcyclohexyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103114452 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | prop-2-enyl 5-methyl-1-(3-methylcyclohexyl)triazole-4-carboxylate |
| SMILES | C=CCOC(=O)c1nnn(C2CCCC(C)C2)c1C |
| InChI | InChI=1S/C14H21N3O2/c1-4-8-19-14(18)13-11(3)17(16-15-13)12-7-5-6-10(2)9-12/h4,10,12H,1,5-9H2,2-3H3 |
| InChIKey | QHEKDIZXPZNTFH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|