C13H17BrN2O3 — CID 103114767
2-bromo-3-methyl-N-[(2-methyl-3-nitrophenyl)methyl]butanamide (PubChem CID 103114767) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is 2-bromo-3-methyl-N-[(2-methyl-3-nitrophenyl)methyl]butanamide.
| Compound Name | 2-bromo-3-methyl-N-[(2-methyl-3-nitrophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 103114767 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-bromo-3-methyl-N-[(2-methyl-3-nitrophenyl)methyl]butanamide |
| SMILES | Cc1c(CNC(=O)C(Br)C(C)C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17BrN2O3/c1-8(2)12(14)13(17)15-7-10-5-4-6-11(9(10)3)16(18)19/h4-6,8,12H,7H2,1-3H3,(H,15,17) |
| InChIKey | VKFGGNCAXGINTM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|