C12H10ClN5O2S — CID 103115219
1-[(5-chlorothiophen-2-yl)methyl]-5-(1-methylpyrazol-4-yl)triazole-4-carboxylic acid (PubChem CID 103115219) has the molecular formula C12H10ClN5O2S and a molecular weight of 323.77 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-5-(1-methylpyrazol-4-yl)triazole-4-carboxylic acid.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-5-(1-methylpyrazol-4-yl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103115219 |
| Molecular Formula | C12H10ClN5O2S |
| Molecular Weight | 323.77 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-5-(1-methylpyrazol-4-yl)triazole-4-carboxylic acid |
| SMILES | Cn1cc(-c2c(C(=O)O)nnn2Cc2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C12H10ClN5O2S/c1-17-5-7(4-14-17)11-10(12(19)20)15-16-18(11)6-8-2-3-9(13)21-8/h2-5H,6H2,1H3,(H,19,20) |
| InChIKey | UMUISJUCTLXVPA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.77 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |