C10H10F3N5O3 — CID 103115530
5-(3-methylimidazol-4-yl)-1-[2-(trifluoromethoxy)ethyl]triazole-4-carboxylic acid (PubChem CID 103115530) has the molecular formula C10H10F3N5O3 and a molecular weight of 305.22 g/mol. Its IUPAC name is 5-(3-methylimidazol-4-yl)-1-[2-(trifluoromethoxy)ethyl]triazole-4-carboxylic acid.
| Compound Name | 5-(3-methylimidazol-4-yl)-1-[2-(trifluoromethoxy)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103115530 |
| Molecular Formula | C10H10F3N5O3 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 5-(3-methylimidazol-4-yl)-1-[2-(trifluoromethoxy)ethyl]triazole-4-carboxylic acid |
| SMILES | Cn1cncc1-c1c(C(=O)O)nnn1CCOC(F)(F)F |
| InChI | InChI=1S/C10H10F3N5O3/c1-17-5-14-4-6(17)8-7(9(19)20)15-16-18(8)2-3-21-10(11,12)13/h4-5H,2-3H2,1H3,(H,19,20) |
| InChIKey | GENKLAJVDWDYDN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |