C12H15N5O — CID 103115712
1,4-diazepan-1-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanone (PubChem CID 103115712) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 1,4-diazepan-1-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanone.
| Compound Name | 1,4-diazepan-1-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanone |
|---|---|
| PubChem CID | 103115712 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 1,4-diazepan-1-yl(pyrazolo[1,5-a]pyrazin-3-yl)methanone |
| SMILES | O=C(c1cnn2ccncc12)N1CCCNCC1 |
| InChI | InChI=1S/C12H15N5O/c18-12(16-5-1-2-13-3-6-16)10-8-15-17-7-4-14-9-11(10)17/h4,7-9,13H,1-3,5-6H2 |
| InChIKey | AAWFNRJLJPUZAO-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |