C16H11ClN2O2 — CID 103119116
1-(4-chlorophenyl)-3-pyrazolo[1,5-a]pyridin-3-ylpropane-1,3-dione (PubChem CID 103119116) has the molecular formula C16H11ClN2O2 and a molecular weight of 298.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-pyrazolo[1,5-a]pyridin-3-ylpropane-1,3-dione.
| Compound Name | 1-(4-chlorophenyl)-3-pyrazolo[1,5-a]pyridin-3-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 103119116 |
| Molecular Formula | C16H11ClN2O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3-pyrazolo[1,5-a]pyridin-3-ylpropane-1,3-dione |
| SMILES | O=C(CC(=O)c1cnn2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11ClN2O2/c17-12-6-4-11(5-7-12)15(20)9-16(21)13-10-18-19-8-2-1-3-14(13)19/h1-8,10H,9H2 |
| InChIKey | DHBVEAGIIDXLAU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|