C16H14N2O3 — CID 103119304
1-(furan-2-yl)-2-methyl-3-(1-methylindazol-3-yl)propane-1,3-dione (PubChem CID 103119304) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-methyl-3-(1-methylindazol-3-yl)propane-1,3-dione.
| Compound Name | 1-(furan-2-yl)-2-methyl-3-(1-methylindazol-3-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 103119304 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-(furan-2-yl)-2-methyl-3-(1-methylindazol-3-yl)propane-1,3-dione |
| SMILES | CC(C(=O)c1ccco1)C(=O)c1nn(C)c2ccccc12 |
| InChI | InChI=1S/C16H14N2O3/c1-10(15(19)13-8-5-9-21-13)16(20)14-11-6-3-4-7-12(11)18(2)17-14/h3-10H,1-2H3 |
| InChIKey | OTLMMJMWBRKTFN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|