C25H22ClFN6O2S2 — CID 10311944
5-chloro-6-[2-[(12-fluoro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)carbamothioyl]hydrazinyl]-N-[(3R)-2-oxothiolan-3-yl]pyridine-3-carboxamide (PubChem CID 10311944) has the molecular formula C25H22ClFN6O2S2 and a molecular weight of 557.08 g/mol. Its IUPAC name is 5-chloro-6-[2-[(12-fluoro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)carbamothioyl]hydrazinyl]-N-[(3R)-2-oxothiolan-3-yl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[2-[(12-fluoro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)carbamothioyl]hydrazinyl]-N-[(3R)-2-oxothiolan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10311944 |
| Molecular Formula | C25H22ClFN6O2S2 |
| Molecular Weight | 557.08 g/mol |
| Exact Mass | 556.09 |
| IUPAC Name | 5-chloro-6-[2-[(12-fluoro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)carbamothioyl]hydrazinyl]-N-[(3R)-2-oxothiolan-3-yl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCSC1=O)c1cnc(NNC(=S)NC2c3cnccc3CCc3c(F)cccc32)c(Cl)c1 |
| InChI | InChI=1S/C25H22ClFN6O2S2/c26-18-10-14(23(34)30-20-7-9-37-24(20)35)11-29-22(18)32-33-25(36)31-21-16-2-1-3-19(27)15(16)5-4-13-6-8-28-12-17(13)21/h1-3,6,8,10-12,20-21H,4-5,7,9H2,(H,29,32)(H,30,34)(H2,31,33,36)/t20-,21?/m1/s1 |
| InChIKey | IFIRFWWXCMSMFH-VQCQRNETSA-N |
| XLogP | 3.71 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.08 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|