C13H14ClN3O3S — CID 103119724
N-(4-chloro-1,1-dioxothiolan-3-yl)-1-methylindazole-3-carboxamide (PubChem CID 103119724) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-1-methylindazole-3-carboxamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-1-methylindazole-3-carboxamide |
|---|---|
| PubChem CID | 103119724 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-1-methylindazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NC2CS(=O)(=O)CC2Cl)c2ccccc21 |
| InChI | InChI=1S/C13H14ClN3O3S/c1-17-11-5-3-2-4-8(11)12(16-17)13(18)15-10-7-21(19,20)6-9(10)14/h2-5,9-10H,6-7H2,1H3,(H,15,18) |
| InChIKey | IARQKVSCLKNYEK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|