C11H11N5 — CID 103119734
1-methyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)indazole (PubChem CID 103119734) has the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. Its IUPAC name is 1-methyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)indazole.
| Compound Name | 1-methyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)indazole |
|---|---|
| PubChem CID | 103119734 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-methyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)indazole |
| SMILES | Cc1nc(-c2nn(C)c3ccccc23)n[nH]1 |
| InChI | InChI=1S/C11H11N5/c1-7-12-11(14-13-7)10-8-5-3-4-6-9(8)16(2)15-10/h3-6H,1-2H3,(H,12,13,14) |
| InChIKey | GKYZTGILMHYUCN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |