C11H14N4O2 — CID 103120076
N-(1-hydroxybutan-2-yl)pyrazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 103120076) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is N-(1-hydroxybutan-2-yl)pyrazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | N-(1-hydroxybutan-2-yl)pyrazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 103120076 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | N-(1-hydroxybutan-2-yl)pyrazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | CCC(CO)NC(=O)c1cnn2ccncc12 |
| InChI | InChI=1S/C11H14N4O2/c1-2-8(7-16)14-11(17)9-5-13-15-4-3-12-6-10(9)15/h3-6,8,16H,2,7H2,1H3,(H,14,17) |
| InChIKey | KQBJFAYUEQAORH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |