C13H17N3O3 — CID 103120182
N-(2-hydroxy-3-methoxypropyl)-1-methylindazole-3-carboxamide (PubChem CID 103120182) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-1-methylindazole-3-carboxamide.
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-1-methylindazole-3-carboxamide |
|---|---|
| PubChem CID | 103120182 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-1-methylindazole-3-carboxamide |
| SMILES | COCC(O)CNC(=O)c1nn(C)c2ccccc12 |
| InChI | InChI=1S/C13H17N3O3/c1-16-11-6-4-3-5-10(11)12(15-16)13(18)14-7-9(17)8-19-2/h3-6,9,17H,7-8H2,1-2H3,(H,14,18) |
| InChIKey | XDNKATJKDOXPLB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |