C15H18N4O2 — CID 103120471
3,3-dimethyl-4-(1-methylindazole-3-carbonyl)piperazin-2-one (PubChem CID 103120471) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3,3-dimethyl-4-(1-methylindazole-3-carbonyl)piperazin-2-one.
| Compound Name | 3,3-dimethyl-4-(1-methylindazole-3-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 103120471 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3,3-dimethyl-4-(1-methylindazole-3-carbonyl)piperazin-2-one |
| SMILES | Cn1nc(C(=O)N2CCNC(=O)C2(C)C)c2ccccc21 |
| InChI | InChI=1S/C15H18N4O2/c1-15(2)14(21)16-8-9-19(15)13(20)12-10-6-4-5-7-11(10)18(3)17-12/h4-7H,8-9H2,1-3H3,(H,16,21) |
| InChIKey | OYYZJJRSUHMONP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |