C31H42F2N2O6 — CID 10312112
1-N-[(2S,3R,4S)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-(oxan-4-yloxy)pentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 10312112) has the molecular formula C31H42F2N2O6 and a molecular weight of 576.68 g/mol. Its IUPAC name is 1-N-[(2S,3R,4S)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-(oxan-4-yloxy)pentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R,4S)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-(oxan-4-yloxy)pentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 10312112 |
| Molecular Formula | C31H42F2N2O6 |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | 1-N-[(2S,3R,4S)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-(oxan-4-yloxy)pentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@@H](O)[C@@H](O)COC2CCOCC2)c1 |
| InChI | InChI=1S/C31H42F2N2O6/c1-4-8-35(9-5-2)31(39)23-13-20(3)12-22(17-23)30(38)34-27(16-21-14-24(32)18-25(33)15-21)29(37)28(36)19-41-26-6-10-40-11-7-26/h12-15,17-18,26-29,36-37H,4-11,16,19H2,1-3H3,(H,34,38)/t27-,28-,29+/m0/s1 |
| InChIKey | WWIAFMPKANREMX-YTCPBCGMSA-N |
| XLogP | 3.79 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |