About 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid
5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 103121378) has the molecular formula C10H15N5O5S
and a molecular weight of 317.33 g/mol. Its IUPAC name is 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid |
| PubChem CID | 103121378 |
| Molecular Formula | C10H15N5O5S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | NCc1c(C(=O)O)nnn1CC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15N5O5S/c11-3-7-9(10(17)18)13-14-15(7)4-8(16)12-6-1-2-21(19,20)5-6/h6H,1-5,11H2,(H,12,16)(H,17,18) |
| InChIKey | QQFPZIJFWLSIAT-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 157.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid?
The IUPAC name of 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid (CID 103121378) is 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid.
What is the SMILES notation for 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid?
The canonical SMILES for 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid is NCc1c(C(=O)O)nnn1CC(=O)NC1CCS(=O)(=O)C1.
What is the InChIKey of 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid?
The InChIKey is QQFPZIJFWLSIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O5S/c11-3-7-9(10(17)18)13-14-15(7)4-8(16)12-6-1-2-21(19,20)5-6/h6H,1-5,11H2,(H,12,16)(H,17,18).
What are the key properties of 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid?
5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid has a molecular weight of 317.33 g/mol, XLogP of -2.26, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-1-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid is sourced from PubChem (CID 103121378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).