About 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid
5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid (PubChem CID 103121667) has the molecular formula C8H12N4O4S
and a molecular weight of 260.27 g/mol. Its IUPAC name is 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid |
| PubChem CID | 103121667 |
| Molecular Formula | C8H12N4O4S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid |
| SMILES | NCc1c(C(=O)O)nnn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H12N4O4S/c9-3-6-7(8(13)14)10-11-12(6)5-1-2-17(15,16)4-5/h5H,1-4,9H2,(H,13,14) |
| InChIKey | HZLUBRSFDNTCDO-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid?
The IUPAC name of 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid (CID 103121667) is 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid.
What is the SMILES notation for 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid?
The canonical SMILES for 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid is NCc1c(C(=O)O)nnn1C1CCS(=O)(=O)C1.
What is the InChIKey of 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid?
The InChIKey is HZLUBRSFDNTCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O4S/c9-3-6-7(8(13)14)10-11-12(6)5-1-2-17(15,16)4-5/h5H,1-4,9H2,(H,13,14).
What are the key properties of 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid?
5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid has a molecular weight of 260.27 g/mol, XLogP of -1.21, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-1-(1,1-dioxothiolan-3-yl)triazole-4-carboxylic acid is sourced from PubChem (CID 103121667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).