C14H17BrN4O — CID 103122477
[2-(2-bromoethyl)piperidin-1-yl]-pyrazolo[1,5-a]pyrazin-3-ylmethanone (PubChem CID 103122477) has the molecular formula C14H17BrN4O and a molecular weight of 337.22 g/mol. Its IUPAC name is [2-(2-bromoethyl)piperidin-1-yl]-pyrazolo[1,5-a]pyrazin-3-ylmethanone.
| Compound Name | [2-(2-bromoethyl)piperidin-1-yl]-pyrazolo[1,5-a]pyrazin-3-ylmethanone |
|---|---|
| PubChem CID | 103122477 |
| Molecular Formula | C14H17BrN4O |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [2-(2-bromoethyl)piperidin-1-yl]-pyrazolo[1,5-a]pyrazin-3-ylmethanone |
| SMILES | O=C(c1cnn2ccncc12)N1CCCCC1CCBr |
| InChI | InChI=1S/C14H17BrN4O/c15-5-4-11-3-1-2-7-18(11)14(20)12-9-17-19-8-6-16-10-13(12)19/h6,8-11H,1-5,7H2 |
| InChIKey | NPRWUCRXUXJJMY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|