C36H40ClF3N2O — CID 10312318
3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-(2,2-dimethylpropyl)aniline (PubChem CID 10312318) has the molecular formula C36H40ClF3N2O and a molecular weight of 609.18 g/mol. Its IUPAC name is 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-(2,2-dimethylpropyl)aniline.
| Compound Name | 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-(2,2-dimethylpropyl)aniline |
|---|---|
| PubChem CID | 10312318 |
| Molecular Formula | C36H40ClF3N2O |
| Molecular Weight | 609.18 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-(2,2-dimethylpropyl)aniline |
| SMILES | CC(C)(C)CNc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C36H40ClF3N2O/c1-35(2,3)26-41-30-18-11-19-31(23-30)43-22-12-21-42(24-29-17-10-20-33(34(29)37)36(38,39)40)25-32(27-13-6-4-7-14-27)28-15-8-5-9-16-28/h4-11,13-20,23,32,41H,12,21-22,24-26H2,1-3H3 |
| InChIKey | OZZQGKDWYUZVOJ-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.18 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|