C35H35ClF3NO3 — CID 10312324
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-2-methylpropanoic acid (PubChem CID 10312324) has the molecular formula C35H35ClF3NO3 and a molecular weight of 610.12 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 10312324 |
| Molecular Formula | C35H35ClF3NO3 |
| Molecular Weight | 610.12 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C35H35ClF3NO3/c1-34(2,33(41)42)28-17-10-18-29(22-28)43-21-11-20-40(23-27-16-9-19-31(32(27)36)35(37,38)39)24-30(25-12-5-3-6-13-25)26-14-7-4-8-15-26/h3-10,12-19,22,30H,11,20-21,23-24H2,1-2H3,(H,41,42) |
| InChIKey | IAXOISXBOXYVMG-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.12 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|