About (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine
(3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine (PubChem CID 103123342) has the molecular formula C16H15N5
and a molecular weight of 277.33 g/mol. Its IUPAC name is (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine |
| PubChem CID | 103123342 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine |
| SMILES | Cn1c(-c2cnn3ccccc23)nc2ccc(CN)cc21 |
| InChI | InChI=1S/C16H15N5/c1-20-15-8-11(9-17)5-6-13(15)19-16(20)12-10-18-21-7-3-2-4-14(12)21/h2-8,10H,9,17H2,1H3 |
| InChIKey | FMEANMQHAKXGCN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine?
The IUPAC name of (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine (CID 103123342) is (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine.
What is the SMILES notation for (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine?
The canonical SMILES for (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine is Cn1c(-c2cnn3ccccc23)nc2ccc(CN)cc21.
What is the InChIKey of (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine?
The InChIKey is FMEANMQHAKXGCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5/c1-20-15-8-11(9-17)5-6-13(15)19-16(20)12-10-18-21-7-3-2-4-14(12)21/h2-8,10H,9,17H2,1H3.
What are the key properties of (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine?
(3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine has a molecular weight of 277.33 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2-pyrazolo[1,5-a]pyridin-3-ylbenzimidazol-5-yl)methanamine is sourced from PubChem (CID 103123342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).