C9H12N6O2 — CID 103123561
2-methyl-2-[5-(1-methylpyrazol-3-yl)tetrazol-1-yl]propanoic acid (PubChem CID 103123561) has the molecular formula C9H12N6O2 and a molecular weight of 236.24 g/mol. Its IUPAC name is 2-methyl-2-[5-(1-methylpyrazol-3-yl)tetrazol-1-yl]propanoic acid.
| Compound Name | 2-methyl-2-[5-(1-methylpyrazol-3-yl)tetrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 103123561 |
| Molecular Formula | C9H12N6O2 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-methyl-2-[5-(1-methylpyrazol-3-yl)tetrazol-1-yl]propanoic acid |
| SMILES | Cn1ccc(-c2nnnn2C(C)(C)C(=O)O)n1 |
| InChI | InChI=1S/C9H12N6O2/c1-9(2,8(16)17)15-7(10-12-13-15)6-4-5-14(3)11-6/h4-5H,1-3H3,(H,16,17) |
| InChIKey | IOSJORSDOXQFIE-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |