C10H8N4S — CID 103123806
4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazol-2-amine (PubChem CID 103123806) has the molecular formula C10H8N4S and a molecular weight of 216.27 g/mol. Its IUPAC name is 4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazol-2-amine.
| Compound Name | 4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 103123806 |
| Molecular Formula | C10H8N4S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2cnn3ccccc23)cs1 |
| InChI | InChI=1S/C10H8N4S/c11-10-13-8(6-15-10)7-5-12-14-4-2-1-3-9(7)14/h1-6H,(H2,11,13) |
| InChIKey | KBLNJVOGHVYXFF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |