C15H18N2O2 — CID 103124735
4-(oxolan-2-yl)-1-pyrazolo[1,5-a]pyridin-3-ylbutan-1-one (PubChem CID 103124735) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-(oxolan-2-yl)-1-pyrazolo[1,5-a]pyridin-3-ylbutan-1-one.
| Compound Name | 4-(oxolan-2-yl)-1-pyrazolo[1,5-a]pyridin-3-ylbutan-1-one |
|---|---|
| PubChem CID | 103124735 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 4-(oxolan-2-yl)-1-pyrazolo[1,5-a]pyridin-3-ylbutan-1-one |
| SMILES | O=C(CCCC1CCCO1)c1cnn2ccccc12 |
| InChI | InChI=1S/C15H18N2O2/c18-15(8-3-5-12-6-4-10-19-12)13-11-16-17-9-2-1-7-14(13)17/h1-2,7,9,11-12H,3-6,8,10H2 |
| InChIKey | QQJKVDBJKFITSG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |