About 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one
3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one (PubChem CID 103125850) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one.
Molecular Properties
| Compound Name | 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one |
| PubChem CID | 103125850 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one |
| SMILES | CC1CC(n2cc[nH]c2=O)CCN1C |
| InChI | InChI=1S/C10H17N3O/c1-8-7-9(3-5-12(8)2)13-6-4-11-10(13)14/h4,6,8-9H,3,5,7H2,1-2H3,(H,11,14) |
| InChIKey | YWSDQTHIVZKFDN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one?
The IUPAC name of 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one (CID 103125850) is 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one.
What is the SMILES notation for 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one?
The canonical SMILES for 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one is CC1CC(n2cc[nH]c2=O)CCN1C.
What is the InChIKey of 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one?
The InChIKey is YWSDQTHIVZKFDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-8-7-9(3-5-12(8)2)13-6-4-11-10(13)14/h4,6,8-9H,3,5,7H2,1-2H3,(H,11,14).
What are the key properties of 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one?
3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one has a molecular weight of 195.27 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-dimethylpiperidin-4-yl)-1H-imidazol-2-one is sourced from PubChem (CID 103125850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).