C13H18N4 — CID 103127642
N-methyl-3-methylidene-1-pyrazolo[1,5-a]pyrazin-3-ylpentan-1-amine (PubChem CID 103127642) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is N-methyl-3-methylidene-1-pyrazolo[1,5-a]pyrazin-3-ylpentan-1-amine.
| Compound Name | N-methyl-3-methylidene-1-pyrazolo[1,5-a]pyrazin-3-ylpentan-1-amine |
|---|---|
| PubChem CID | 103127642 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-methyl-3-methylidene-1-pyrazolo[1,5-a]pyrazin-3-ylpentan-1-amine |
| SMILES | C=C(CC)CC(NC)c1cnn2ccncc12 |
| InChI | InChI=1S/C13H18N4/c1-4-10(2)7-12(14-3)11-8-16-17-6-5-15-9-13(11)17/h5-6,8-9,12,14H,2,4,7H2,1,3H3 |
| InChIKey | ZKBXOHAHMCWMOJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|