About (2R)-5-aminopentan-2-ol
(2R)-5-aminopentan-2-ol (PubChem CID 10313090) has the molecular formula C5H13NO
and a molecular weight of 103.16 g/mol. Its IUPAC name is (2R)-5-aminopentan-2-ol.
Molecular Properties
| Compound Name | (2R)-5-aminopentan-2-ol |
| PubChem CID | 10313090 |
| Molecular Formula | C5H13NO |
| Molecular Weight | 103.16 g/mol |
| Exact Mass | 103.10 |
| IUPAC Name | (2R)-5-aminopentan-2-ol |
| SMILES | C[C@@H](O)CCCN |
| InChI | InChI=1S/C5H13NO/c1-5(7)3-2-4-6/h5,7H,2-4,6H2,1H3/t5-/m1/s1 |
| InChIKey | VJGRDSFPHUTBBE-RXMQYKEDSA-N |
| XLogP | 0.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.16 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-5-aminopentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-aminopentan-2-ol?
The IUPAC name of (2R)-5-aminopentan-2-ol (CID 10313090) is (2R)-5-aminopentan-2-ol.
What is the SMILES notation for (2R)-5-aminopentan-2-ol?
The canonical SMILES for (2R)-5-aminopentan-2-ol is C[C@@H](O)CCCN.
What is the InChIKey of (2R)-5-aminopentan-2-ol?
The InChIKey is VJGRDSFPHUTBBE-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H13NO/c1-5(7)3-2-4-6/h5,7H,2-4,6H2,1H3/t5-/m1/s1.
What are the key properties of (2R)-5-aminopentan-2-ol?
(2R)-5-aminopentan-2-ol has a molecular weight of 103.16 g/mol, XLogP of 0.11, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-aminopentan-2-ol is sourced from PubChem (CID 10313090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).