About 2-(aminomethyl)propane-1,3-diamine
2-(aminomethyl)propane-1,3-diamine (PubChem CID 10313091) has the molecular formula C4H13N3
and a molecular weight of 103.17 g/mol. Its IUPAC name is 2-(aminomethyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | 2-(aminomethyl)propane-1,3-diamine |
| PubChem CID | 10313091 |
| Molecular Formula | C4H13N3 |
| Molecular Weight | 103.17 g/mol |
| Exact Mass | 103.11 |
| IUPAC Name | 2-(aminomethyl)propane-1,3-diamine |
| SMILES | NCC(CN)CN |
| InChI | InChI=1S/C4H13N3/c5-1-4(2-6)3-7/h4H,1-3,5-7H2 |
| InChIKey | XXZJETFEIRYFCD-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.17 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(aminomethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)propane-1,3-diamine?
The IUPAC name of 2-(aminomethyl)propane-1,3-diamine (CID 10313091) is 2-(aminomethyl)propane-1,3-diamine.
What is the SMILES notation for 2-(aminomethyl)propane-1,3-diamine?
The canonical SMILES for 2-(aminomethyl)propane-1,3-diamine is NCC(CN)CN.
What is the InChIKey of 2-(aminomethyl)propane-1,3-diamine?
The InChIKey is XXZJETFEIRYFCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H13N3/c5-1-4(2-6)3-7/h4H,1-3,5-7H2.
What are the key properties of 2-(aminomethyl)propane-1,3-diamine?
2-(aminomethyl)propane-1,3-diamine has a molecular weight of 103.17 g/mol, XLogP of -1.52, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)propane-1,3-diamine is sourced from PubChem (CID 10313091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).