C14H18FN3O — CID 103131244
N-[(2-fluoro-4-methoxyphenyl)-(1-methylpyrazol-3-yl)methyl]ethanamine (PubChem CID 103131244) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is N-[(2-fluoro-4-methoxyphenyl)-(1-methylpyrazol-3-yl)methyl]ethanamine.
| Compound Name | N-[(2-fluoro-4-methoxyphenyl)-(1-methylpyrazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103131244 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N-[(2-fluoro-4-methoxyphenyl)-(1-methylpyrazol-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccn(C)n1)c1ccc(OC)cc1F |
| InChI | InChI=1S/C14H18FN3O/c1-4-16-14(13-7-8-18(2)17-13)11-6-5-10(19-3)9-12(11)15/h5-9,14,16H,4H2,1-3H3 |
| InChIKey | IPGBDQIAVNOVRR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |