About (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one
(1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one (PubChem CID 10313167) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one.
Molecular Properties
| Compound Name | (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one |
| PubChem CID | 10313167 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one |
| SMILES | CC1(C)[C@H]2CCC(=O)[C@@H]1C2 |
| InChI | InChI=1S/C9H14O/c1-9(2)6-3-4-8(10)7(9)5-6/h6-7H,3-5H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | XZFDKWMYCUEKSS-BQBZGAKWSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one?
The IUPAC name of (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one (CID 10313167) is (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one.
What is the SMILES notation for (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one?
The canonical SMILES for (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one is CC1(C)[C@H]2CCC(=O)[C@@H]1C2.
What is the InChIKey of (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one?
The InChIKey is XZFDKWMYCUEKSS-BQBZGAKWSA-N. The full InChI is InChI=1S/C9H14O/c1-9(2)6-3-4-8(10)7(9)5-6/h6-7H,3-5H2,1-2H3/t6-,7-/m0/s1.
What are the key properties of (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one?
(1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one has a molecular weight of 138.21 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-6,6-dimethylbicyclo[3.1.1]heptan-2-one is sourced from PubChem (CID 10313167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).