About 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one
6-hydroxy-4,5-dimethyl-1H-pyridin-2-one (PubChem CID 10313171) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one |
| PubChem CID | 10313171 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one |
| SMILES | Cc1cc(=O)[nH]c(O)c1C |
| InChI | InChI=1S/C7H9NO2/c1-4-3-6(9)8-7(10)5(4)2/h3H,1-2H3,(H2,8,9,10) |
| InChIKey | KIEGFAYDOKCBOK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one?
The IUPAC name of 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one (CID 10313171) is 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one.
What is the SMILES notation for 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one?
The canonical SMILES for 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one is Cc1cc(=O)[nH]c(O)c1C.
What is the InChIKey of 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one?
The InChIKey is KIEGFAYDOKCBOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-4-3-6(9)8-7(10)5(4)2/h3H,1-2H3,(H2,8,9,10).
What are the key properties of 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one?
6-hydroxy-4,5-dimethyl-1H-pyridin-2-one has a molecular weight of 139.15 g/mol, XLogP of 0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-4,5-dimethyl-1H-pyridin-2-one is sourced from PubChem (CID 10313171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).