C6H13NO3 — CID 10313212
(2R,3S,4R)-2-(hydroxymethyl)piperidine-3,4-diol (PubChem CID 10313212) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)piperidine-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 10313212 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)piperidine-3,4-diol |
| SMILES | OC[C@H]1NCC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H13NO3/c8-3-4-6(10)5(9)1-2-7-4/h4-10H,1-3H2/t4-,5-,6+/m1/s1 |
| InChIKey | YZNNBIPIQWYLDM-PBXRRBTRSA-N |
| XLogP | -1.94 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |