About 2-pyridin-2-ylpyrimidine
2-pyridin-2-ylpyrimidine (PubChem CID 10313237) has the molecular formula C9H7N3
and a molecular weight of 157.18 g/mol. Its IUPAC name is 2-pyridin-2-ylpyrimidine.
Molecular Properties
| Compound Name | 2-pyridin-2-ylpyrimidine |
| PubChem CID | 10313237 |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 157.18 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 2-pyridin-2-ylpyrimidine |
| SMILES | c1ccc(-c2ncccn2)nc1 |
| InChI | InChI=1S/C9H7N3/c1-2-5-10-8(4-1)9-11-6-3-7-12-9/h1-7H |
| InChIKey | YJVKLLJCUMQBHN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridin-2-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylpyrimidine?
The IUPAC name of 2-pyridin-2-ylpyrimidine (CID 10313237) is 2-pyridin-2-ylpyrimidine.
What is the SMILES notation for 2-pyridin-2-ylpyrimidine?
The canonical SMILES for 2-pyridin-2-ylpyrimidine is c1ccc(-c2ncccn2)nc1.
What is the InChIKey of 2-pyridin-2-ylpyrimidine?
The InChIKey is YJVKLLJCUMQBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3/c1-2-5-10-8(4-1)9-11-6-3-7-12-9/h1-7H.
What are the key properties of 2-pyridin-2-ylpyrimidine?
2-pyridin-2-ylpyrimidine has a molecular weight of 157.18 g/mol, XLogP of 1.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylpyrimidine is sourced from PubChem (CID 10313237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).