C16H24BrNO2 — CID 103132827
N-[[5-bromo-2-[(5-methyloxolan-2-yl)methoxy]phenyl]methyl]propan-1-amine (PubChem CID 103132827) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is N-[[5-bromo-2-[(5-methyloxolan-2-yl)methoxy]phenyl]methyl]propan-1-amine.
| Compound Name | N-[[5-bromo-2-[(5-methyloxolan-2-yl)methoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 103132827 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[[5-bromo-2-[(5-methyloxolan-2-yl)methoxy]phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(Br)ccc1OCC1CCC(C)O1 |
| InChI | InChI=1S/C16H24BrNO2/c1-3-8-18-10-13-9-14(17)5-7-16(13)19-11-15-6-4-12(2)20-15/h5,7,9,12,15,18H,3-4,6,8,10-11H2,1-2H3 |
| InChIKey | QPOGBBUSWHILCN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|