C16H15N3O — CID 103133944
isoquinolin-8-yl-(1,3,5-trimethylpyrazol-4-yl)methanone (PubChem CID 103133944) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is isoquinolin-8-yl-(1,3,5-trimethylpyrazol-4-yl)methanone.
| Compound Name | isoquinolin-8-yl-(1,3,5-trimethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 103133944 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | isoquinolin-8-yl-(1,3,5-trimethylpyrazol-4-yl)methanone |
| SMILES | Cc1nn(C)c(C)c1C(=O)c1cccc2ccncc12 |
| InChI | InChI=1S/C16H15N3O/c1-10-15(11(2)19(3)18-10)16(20)13-6-4-5-12-7-8-17-9-14(12)13/h4-9H,1-3H3 |
| InChIKey | MJDZJJGYGGNBMF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |