2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid

C10H17NO2 — CID 10313401

IUPAC2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid
SMILESNCC1(CC(=O)O)C[C@H]2CC[C@H]2C1
InChIInChI=1S/C10H17NO2/c11-6-10(5-9(12)13)3-7-1-2-8(7)4-10/h7-8H,1-6,11H2,(H,12,13)/t7-,8+,10?
InChIKeyNDDZVQRQVFTNSN-JWHQNHQBSA-N
MW183.25 g/mol
LogP1.23
Rot. Bonds3

About 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid

2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid (PubChem CID 10313401) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid.

Molecular Properties

Compound Name2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid
PubChem CID10313401
Molecular FormulaC10H17NO2
Molecular Weight183.25 g/mol
Exact Mass183.13
IUPAC Name2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid
SMILESNCC1(CC(=O)O)C[C@H]2CC[C@H]2C1
InChIInChI=1S/C10H17NO2/c11-6-10(5-9(12)13)3-7-1-2-8(7)4-10/h7-8H,1-6,11H2,(H,12,13)/t7-,8+,10?
InChIKeyNDDZVQRQVFTNSN-JWHQNHQBSA-N
XLogP1.23
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.25
LogP ≤ 51.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid?
The IUPAC name of 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid (CID 10313401) is 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid.
What is the SMILES notation for 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid?
The canonical SMILES for 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid is NCC1(CC(=O)O)C[C@H]2CC[C@H]2C1.
What is the InChIKey of 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid?
The InChIKey is NDDZVQRQVFTNSN-JWHQNHQBSA-N. The full InChI is InChI=1S/C10H17NO2/c11-6-10(5-9(12)13)3-7-1-2-8(7)4-10/h7-8H,1-6,11H2,(H,12,13)/t7-,8+,10?.
What are the key properties of 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid?
2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid has a molecular weight of 183.25 g/mol, XLogP of 1.23, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,5R)-3-(aminomethyl)-3-bicyclo[3.2.0]heptanyl]acetic acid is sourced from PubChem (CID 10313401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).