About 4-methoxy-TEMPO
4-methoxy-TEMPO (PubChem CID 10313435) has the molecular formula C10H20NO2
and a molecular weight of 186.27 g/mol.
Molecular Properties
| Compound Name | 4-methoxy-TEMPO |
| PubChem CID | 10313435 |
| Molecular Formula | C10H20NO2 |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | — |
| SMILES | COC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C10H20NO2/c1-9(2)6-8(13-5)7-10(3,4)11(9)12/h8H,6-7H2,1-5H3 |
| InChIKey | SFXHWRCRQNGVLJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-TEMPO with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-TEMPO?
The IUPAC name of 4-methoxy-TEMPO (CID 10313435) is not available.
What is the SMILES notation for 4-methoxy-TEMPO?
The canonical SMILES for 4-methoxy-TEMPO is COC1CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of 4-methoxy-TEMPO?
The InChIKey is SFXHWRCRQNGVLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20NO2/c1-9(2)6-8(13-5)7-10(3,4)11(9)12/h8H,6-7H2,1-5H3.
What are the key properties of 4-methoxy-TEMPO?
4-methoxy-TEMPO has a molecular weight of 186.27 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-TEMPO is sourced from PubChem (CID 10313435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).